C23H24N4OS — CID 43812159
2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 43812159) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 43812159 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CC(C)c1ccc2nc(SCC(=O)Nc3ccc(N(C)C)cc3)c(C#N)cc2c1 |
| InChI | InChI=1S/C23H24N4OS/c1-15(2)16-5-10-21-17(11-16)12-18(13-24)23(26-21)29-14-22(28)25-19-6-8-20(9-7-19)27(3)4/h5-12,15H,14H2,1-4H3,(H,25,28) |
| InChIKey | KUVMDTQVXSZZCU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|