C21H18ClN3OS — CID 43812152
N-(2-chlorophenyl)-2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetamide (PubChem CID 43812152) has the molecular formula C21H18ClN3OS and a molecular weight of 395.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 43812152 |
| Molecular Formula | C21H18ClN3OS |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetamide |
| SMILES | CC(C)c1ccc2nc(SCC(=O)Nc3ccccc3Cl)c(C#N)cc2c1 |
| InChI | InChI=1S/C21H18ClN3OS/c1-13(2)14-7-8-18-15(9-14)10-16(11-23)21(25-18)27-12-20(26)24-19-6-4-3-5-17(19)22/h3-10,13H,12H2,1-2H3,(H,24,26) |
| InChIKey | AOFCGKWODQHKGG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |