C17H18N2O2S — CID 3207603
ethyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate (PubChem CID 3207603) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is ethyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate.
| Compound Name | ethyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3207603 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | ethyl 2-(3-cyano-6-propan-2-ylquinolin-2-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2ccc(C(C)C)cc2cc1C#N |
| InChI | InChI=1S/C17H18N2O2S/c1-4-21-16(20)10-22-17-14(9-18)8-13-7-12(11(2)3)5-6-15(13)19-17/h5-8,11H,4,10H2,1-3H3 |
| InChIKey | XOCMAZHPHHFBMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |