C20H22BrNO5 — CID 12995890
dimethyl 2-(3-bromophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate (PubChem CID 12995890) has the molecular formula C20H22BrNO5 and a molecular weight of 436.30 g/mol. Its IUPAC name is dimethyl 2-(3-bromophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(3-bromophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 12995890 |
| Molecular Formula | C20H22BrNO5 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | dimethyl 2-(3-bromophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2cccc(Br)c2)c1C(=O)OC |
| InChI | InChI=1S/C20H22BrNO5/c1-25-19(23)15-16(20(24)26-2)18(22-14-9-4-3-5-10-14)27-17(15)12-7-6-8-13(21)11-12/h6-8,11,14,22H,3-5,9-10H2,1-2H3 |
| InChIKey | OHYTUIMFKGLRPO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |