C20H21NO3 — CID 12024772
2-(cyclohexylamino)-6-methyl-3-phenylfuro[3,2-c]pyran-4-one (PubChem CID 12024772) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(cyclohexylamino)-6-methyl-3-phenylfuro[3,2-c]pyran-4-one.
| Compound Name | 2-(cyclohexylamino)-6-methyl-3-phenylfuro[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 12024772 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(cyclohexylamino)-6-methyl-3-phenylfuro[3,2-c]pyran-4-one |
| SMILES | Cc1cc2oc(NC3CCCCC3)c(-c3ccccc3)c2c(=O)o1 |
| InChI | InChI=1S/C20H21NO3/c1-13-12-16-18(20(22)23-13)17(14-8-4-2-5-9-14)19(24-16)21-15-10-6-3-7-11-15/h2,4-5,8-9,12,15,21H,3,6-7,10-11H2,1H3 |
| InChIKey | RFWNCSJZEOKQAV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |