C20H20N2O5 — CID 12024771
2-(cyclohexylamino)-6-methyl-3-(4-nitrophenyl)furo[3,2-c]pyran-4-one (PubChem CID 12024771) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-(cyclohexylamino)-6-methyl-3-(4-nitrophenyl)furo[3,2-c]pyran-4-one.
| Compound Name | 2-(cyclohexylamino)-6-methyl-3-(4-nitrophenyl)furo[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 12024771 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-(cyclohexylamino)-6-methyl-3-(4-nitrophenyl)furo[3,2-c]pyran-4-one |
| SMILES | Cc1cc2oc(NC3CCCCC3)c(-c3ccc([N+](=O)[O-])cc3)c2c(=O)o1 |
| InChI | InChI=1S/C20H20N2O5/c1-12-11-16-18(20(23)26-12)17(13-7-9-15(10-8-13)22(24)25)19(27-16)21-14-5-3-2-4-6-14/h7-11,14,21H,2-6H2,1H3 |
| InChIKey | DMYAGYQFZPTAHJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|