C13H19NO4 — CID 130003921
tert-butyl 3-methylidene-2-oxo-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyridine-5-carboxylate (PubChem CID 130003921) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is tert-butyl 3-methylidene-2-oxo-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-methylidene-2-oxo-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 130003921 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | tert-butyl 3-methylidene-2-oxo-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyridine-5-carboxylate |
| SMILES | C=C1C(=O)OC2CCN(C(=O)OC(C)(C)C)CC12 |
| InChI | InChI=1S/C13H19NO4/c1-8-9-7-14(12(16)18-13(2,3)4)6-5-10(9)17-11(8)15/h9-10H,1,5-7H2,2-4H3 |
| InChIKey | LQPLFVHWIONDNT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|