C11H19NO6S — CID 164860569
tert-butyl 2,2-dioxo-3a,4,5,7,8,8a-hexahydro-[1,3,2]dioxathiolo[4,5-d]azepine-6-carboxylate (PubChem CID 164860569) has the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. Its IUPAC name is tert-butyl 2,2-dioxo-3a,4,5,7,8,8a-hexahydro-[1,3,2]dioxathiolo[4,5-d]azepine-6-carboxylate.
| Compound Name | tert-butyl 2,2-dioxo-3a,4,5,7,8,8a-hexahydro-[1,3,2]dioxathiolo[4,5-d]azepine-6-carboxylate |
|---|---|
| PubChem CID | 164860569 |
| Molecular Formula | C11H19NO6S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | tert-butyl 2,2-dioxo-3a,4,5,7,8,8a-hexahydro-[1,3,2]dioxathiolo[4,5-d]azepine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2OS(=O)(=O)OC2CC1 |
| InChI | InChI=1S/C11H19NO6S/c1-11(2,3)16-10(13)12-6-4-8-9(5-7-12)18-19(14,15)17-8/h8-9H,4-7H2,1-3H3 |
| InChIKey | XGTPGFNDBYPADF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |