C4H2O3 — CID 13000553
3,4-dideuteriofuran-2,5-dione (PubChem CID 13000553) has the molecular formula C4H2O3 and a molecular weight of 100.07 g/mol. Its IUPAC name is 3,4-dideuteriofuran-2,5-dione.
| Compound Name | 3,4-dideuteriofuran-2,5-dione |
|---|---|
| PubChem CID | 13000553 |
| Molecular Formula | C4H2O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.01 |
| IUPAC Name | 3,4-dideuteriofuran-2,5-dione |
| SMILES | [2H]C1=C([2H])C(=O)OC1=O |
| InChI | InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H/i1D,2D |
| InChIKey | FPYJFEHAWHCUMM-QDNHWIQGSA-N |
| XLogP | -0.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.07 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|