About furan-2,5-dione
furan-2,5-dione (PubChem CID 7923) has the molecular formula C4H2O3
and a molecular weight of 98.06 g/mol. Its IUPAC name is furan-2,5-dione.
Molecular Properties
| Compound Name | furan-2,5-dione |
| PubChem CID | 7923 |
| Molecular Formula | C4H2O3 |
| Molecular Weight | 98.06 g/mol |
| Exact Mass | 98.00 |
| IUPAC Name | furan-2,5-dione |
| SMILES | O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H |
| InChIKey | FPYJFEHAWHCUMM-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.06 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione?
The IUPAC name of furan-2,5-dione (CID 7923) is furan-2,5-dione.
What is the SMILES notation for furan-2,5-dione?
The canonical SMILES for furan-2,5-dione is O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione?
The InChIKey is FPYJFEHAWHCUMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H.
What are the key properties of furan-2,5-dione?
furan-2,5-dione has a molecular weight of 98.06 g/mol, XLogP of -0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione is sourced from PubChem (CID 7923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).