C10H11Cl2N — CID 130006231
N-(3,3-dichloro-2-methylprop-2-enyl)aniline (PubChem CID 130006231) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is N-(3,3-dichloro-2-methylprop-2-enyl)aniline.
| Compound Name | N-(3,3-dichloro-2-methylprop-2-enyl)aniline |
|---|---|
| PubChem CID | 130006231 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | N-(3,3-dichloro-2-methylprop-2-enyl)aniline |
| SMILES | CC(CNc1ccccc1)=C(Cl)Cl |
| InChI | InChI=1S/C10H11Cl2N/c1-8(10(11)12)7-13-9-5-3-2-4-6-9/h2-6,13H,7H2,1H3 |
| InChIKey | JCXFVNUOOQPKNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |