C9H9Cl2N — CID 79167902
N-(2,3-dichloroprop-2-enyl)aniline (PubChem CID 79167902) has the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)aniline.
| Compound Name | N-(2,3-dichloroprop-2-enyl)aniline |
|---|---|
| PubChem CID | 79167902 |
| Molecular Formula | C9H9Cl2N |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)aniline |
| SMILES | ClC=C(Cl)CNc1ccccc1 |
| InChI | InChI=1S/C9H9Cl2N/c10-6-8(11)7-12-9-4-2-1-3-5-9/h1-6,12H,7H2 |
| InChIKey | UUVFWFCBNZHGEO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |