C11H18N2O — CID 130007097
2,9,9-trimethyl-3,5-diazatricyclo[6.1.1.02,6]decan-4-one (PubChem CID 130007097) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,9,9-trimethyl-3,5-diazatricyclo[6.1.1.02,6]decan-4-one.
| Compound Name | 2,9,9-trimethyl-3,5-diazatricyclo[6.1.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 130007097 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2,9,9-trimethyl-3,5-diazatricyclo[6.1.1.02,6]decan-4-one |
| SMILES | CC1(C)C2CC3NC(=O)NC3(C)C1C2 |
| InChI | InChI=1S/C11H18N2O/c1-10(2)6-4-7(10)11(3)8(5-6)12-9(14)13-11/h6-8H,4-5H2,1-3H3,(H2,12,13,14) |
| InChIKey | JNTZSYUNJIEOAB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |