C11H20N2OS — CID 163943587
(3aS,4S,6aR)-3a-methyl-4-pentyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one (PubChem CID 163943587) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is (3aS,4S,6aR)-3a-methyl-4-pentyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-3a-methyl-4-pentyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 163943587 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3aS,4S,6aR)-3a-methyl-4-pentyl-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-2-one |
| SMILES | CCCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@]21C |
| InChI | InChI=1S/C11H20N2OS/c1-3-4-5-6-9-11(2)8(7-15-9)12-10(14)13-11/h8-9H,3-7H2,1-2H3,(H2,12,13,14)/t8-,9-,11-/m0/s1 |
| InChIKey | RTDYORLCSLRAJF-QXEWZRGKSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|