C19H34N4O3S — CID 163721118
5-[(3aR,6aS)-3a-methyl-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-(methylamino)-6-oxoheptyl]pentanamide (PubChem CID 163721118) has the molecular formula C19H34N4O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is 5-[(3aR,6aS)-3a-methyl-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-(methylamino)-6-oxoheptyl]pentanamide.
| Compound Name | 5-[(3aR,6aS)-3a-methyl-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-(methylamino)-6-oxoheptyl]pentanamide |
|---|---|
| PubChem CID | 163721118 |
| Molecular Formula | C19H34N4O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 5-[(3aR,6aS)-3a-methyl-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-N-[(5S)-5-(methylamino)-6-oxoheptyl]pentanamide |
| SMILES | CN[C@@H](CCCCNC(=O)CCCCC1SC[C@H]2NC(=O)N[C@@]12C)C(C)=O |
| InChI | InChI=1S/C19H34N4O3S/c1-13(24)14(20-3)8-6-7-11-21-17(25)10-5-4-9-16-19(2)15(12-27-16)22-18(26)23-19/h14-16,20H,4-12H2,1-3H3,(H,21,25)(H2,22,23,26)/t14-,15+,16?,19+/m0/s1 |
| InChIKey | KRRKLXUYZVAQFV-ZUHAFGJZSA-N |
| XLogP | 1.57 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|