C17H28N5O4S+ — CID 163926501
[(3aR,6aR)-4-[5-[(5-amino-5-carboxypentyl)amino]-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium (PubChem CID 163926501) has the molecular formula C17H28N5O4S+ and a molecular weight of 398.51 g/mol. Its IUPAC name is [(3aR,6aR)-4-[5-[(5-amino-5-carboxypentyl)amino]-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium.
| Compound Name | [(3aR,6aR)-4-[5-[(5-amino-5-carboxypentyl)amino]-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163926501 |
| Molecular Formula | C17H28N5O4S+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(3aR,6aR)-4-[5-[(5-amino-5-carboxypentyl)amino]-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium |
| SMILES | C#[N+][C@]12NC(=O)N[C@H]1CSC2CCCCC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C17H27N5O4S/c1-19-17-12(21-16(26)22-17)10-27-13(17)7-2-3-8-14(23)20-9-5-4-6-11(18)15(24)25/h1,11-13H,2-10,18H2,(H3-,20,21,22,23,24,25,26)/p+1/t11?,12-,13?,17-/m0/s1 |
| InChIKey | BHTRTIZOWSEQPD-JDSMKDRWSA-O |
| XLogP | 0.70 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|