C31H38F3N5O7S — CID 87395731
2-amino-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid;(2,2,2-trifluoroacetyl) 4-anilinobenzoate (PubChem CID 87395731) has the molecular formula C31H38F3N5O7S and a molecular weight of 681.73 g/mol. Its IUPAC name is 2-amino-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid;(2,2,2-trifluoroacetyl) 4-anilinobenzoate.
| Compound Name | 2-amino-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid;(2,2,2-trifluoroacetyl) 4-anilinobenzoate |
|---|---|
| PubChem CID | 87395731 |
| Molecular Formula | C31H38F3N5O7S |
| Molecular Weight | 681.73 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 2-amino-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoic acid;(2,2,2-trifluoroacetyl) 4-anilinobenzoate |
| SMILES | NC(CCCCNC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)O.O=C(OC(=O)C(F)(F)F)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H28N4O4S.C15H10F3NO3/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14;16-15(17,18)14(21)22-13(20)10-6-8-12(9-7-10)19-11-4-2-1-3-5-11/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24);1-9,19H |
| InChIKey | PEZMVSZFEAPYNC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|