C16H28N5O2S+ — CID 163507593
[(3aR,6aR)-4-[5-(5-aminopentylamino)-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium (PubChem CID 163507593) has the molecular formula C16H28N5O2S+ and a molecular weight of 354.50 g/mol. Its IUPAC name is [(3aR,6aR)-4-[5-(5-aminopentylamino)-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium.
| Compound Name | [(3aR,6aR)-4-[5-(5-aminopentylamino)-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163507593 |
| Molecular Formula | C16H28N5O2S+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | [(3aR,6aR)-4-[5-(5-aminopentylamino)-5-oxopentyl]-2-oxo-3,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-3a-yl]-methylidyneazanium |
| SMILES | C#[N+][C@]12NC(=O)N[C@H]1CSC2CCCCC(=O)NCCCCCN |
| InChI | InChI=1S/C16H27N5O2S/c1-18-16-12(20-15(23)21-16)11-24-13(16)7-3-4-8-14(22)19-10-6-2-5-9-17/h1,12-13H,2-11,17H2,(H2-,19,20,21,22,23)/p+1/t12-,13?,16-/m0/s1 |
| InChIKey | MVZKFTHAMZURRJ-BSBHGOPBSA-O |
| XLogP | 1.25 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|