C8H10ClN5 — CID 130009288
1-(3-chloro-2-pyridinyl)-2-(4,5-dihydro-1H-imidazol-2-yl)hydrazine (PubChem CID 130009288) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-2-(4,5-dihydro-1H-imidazol-2-yl)hydrazine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-2-(4,5-dihydro-1H-imidazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 130009288 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-2-(4,5-dihydro-1H-imidazol-2-yl)hydrazine |
| SMILES | Clc1cccnc1NNC1=NCCN1 |
| InChI | InChI=1S/C8H10ClN5/c9-6-2-1-3-10-7(6)13-14-8-11-4-5-12-8/h1-3H,4-5H2,(H,10,13)(H2,11,12,14) |
| InChIKey | QFXGXVZFQVJUOX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|