C12H19NO — CID 130011074
N-(5-methyl-1-tricyclo[3.2.2.02,4]nonanyl)acetamide (PubChem CID 130011074) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(5-methyl-1-tricyclo[3.2.2.02,4]nonanyl)acetamide.
| Compound Name | N-(5-methyl-1-tricyclo[3.2.2.02,4]nonanyl)acetamide |
|---|---|
| PubChem CID | 130011074 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(5-methyl-1-tricyclo[3.2.2.02,4]nonanyl)acetamide |
| SMILES | CC(=O)NC12CCC(C)(CC1)C1CC12 |
| InChI | InChI=1S/C12H19NO/c1-8(14)13-12-5-3-11(2,4-6-12)9-7-10(9)12/h9-10H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | JANDLTPHDGUVKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |