C8H9ClN2O3 — CID 130012614
2-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)acetyl chloride (PubChem CID 130012614) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)acetyl chloride.
| Compound Name | 2-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)acetyl chloride |
|---|---|
| PubChem CID | 130012614 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)acetyl chloride |
| SMILES | Cc1c(C)n(CC(=O)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9ClN2O3/c1-4-5(2)11(3-6(9)12)8(14)10-7(4)13/h3H2,1-2H3,(H,10,13,14) |
| InChIKey | UKHOOTZLYANMFP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|