C20H32N2O4 — CID 166946524
6-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethylcyclopentane-1-carboxylate (PubChem CID 166946524) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 6-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethylcyclopentane-1-carboxylate.
| Compound Name | 6-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 166946524 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 6-(5,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethylcyclopentane-1-carboxylate |
| SMILES | Cc1c(C)n(CCCCCCOC(=O)C2CC(C)CC2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H32N2O4/c1-13-11-14(2)17(12-13)19(24)26-10-8-6-5-7-9-22-16(4)15(3)18(23)21-20(22)25/h13-14,17H,5-12H2,1-4H3,(H,21,23,25) |
| InChIKey | DKJHVICXIWJQBX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|