About 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine
7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine (PubChem CID 130013666) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine.
Molecular Properties
| Compound Name | 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine |
| PubChem CID | 130013666 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine |
| SMILES | CC1=CC=CN=C(OC(C)(C)C)N1 |
| InChI | InChI=1S/C10H16N2O/c1-8-6-5-7-11-9(12-8)13-10(2,3)4/h5-7H,1-4H3,(H,11,12) |
| InChIKey | GENYZSSTVRAPKE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine?
The IUPAC name of 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine (CID 130013666) is 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine.
What is the SMILES notation for 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine?
The canonical SMILES for 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine is CC1=CC=CN=C(OC(C)(C)C)N1.
What is the InChIKey of 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine?
The InChIKey is GENYZSSTVRAPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-8-6-5-7-11-9(12-8)13-10(2,3)4/h5-7H,1-4H3,(H,11,12).
What are the key properties of 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine?
7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine has a molecular weight of 180.25 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-[(2-methylpropan-2-yl)oxy]-1H-1,3-diazepine is sourced from PubChem (CID 130013666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).