About methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate
methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate (PubChem CID 130014232) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate.
Analyze methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate (CID 130014232) is methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate is COC(=O)c1ncsc1NC(C)C.
What is the InChIKey of methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate?
The InChIKey is FQJHIABFJIUYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-5(2)10-7-6(8(11)12-3)9-4-13-7/h4-5,10H,1-3H3.
What are the key properties of methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate?
methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate has a molecular weight of 200.26 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(propan-2-ylamino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 130014232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).