5-(ethylamino)-1,3-thiazole-4-carboxylic acid

C6H8N2O2S — CID 64631696

IUPAC5-(ethylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCNc1scnc1C(=O)O
InChIInChI=1S/C6H8N2O2S/c1-2-7-5-4(6(9)10)8-3-11-5/h3,7H,2H2,1H3,(H,9,10)
InChIKeyUBTQZDUPIHEWEI-UHFFFAOYSA-N
MW172.21 g/mol
LogP1.27
Rot. Bonds3

About 5-(ethylamino)-1,3-thiazole-4-carboxylic acid

5-(ethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631696) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 5-(ethylamino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(ethylamino)-1,3-thiazole-4-carboxylic acid
PubChem CID64631696
Molecular FormulaC6H8N2O2S
Molecular Weight172.21 g/mol
Exact Mass172.03
IUPAC Name5-(ethylamino)-1,3-thiazole-4-carboxylic acid
SMILESCCNc1scnc1C(=O)O
InChIInChI=1S/C6H8N2O2S/c1-2-7-5-4(6(9)10)8-3-11-5/h3,7H,2H2,1H3,(H,9,10)
InChIKeyUBTQZDUPIHEWEI-UHFFFAOYSA-N
XLogP1.27
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(ethylamino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(ethylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(ethylamino)-1,3-thiazole-4-carboxylic acid (CID 64631696) is 5-(ethylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(ethylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(ethylamino)-1,3-thiazole-4-carboxylic acid is CCNc1scnc1C(=O)O.
What is the InChIKey of 5-(ethylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is UBTQZDUPIHEWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-7-5-4(6(9)10)8-3-11-5/h3,7H,2H2,1H3,(H,9,10).
What are the key properties of 5-(ethylamino)-1,3-thiazole-4-carboxylic acid?
5-(ethylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 172.21 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 64631696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).