C6H8N2O2S — CID 64631696
5-(ethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 64631696) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 5-(ethylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(ethylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64631696 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 5-(ethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CCNc1scnc1C(=O)O |
| InChI | InChI=1S/C6H8N2O2S/c1-2-7-5-4(6(9)10)8-3-11-5/h3,7H,2H2,1H3,(H,9,10) |
| InChIKey | UBTQZDUPIHEWEI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |