5-amino-1,3-thiazole-4-carboxylic acid

C4H4N2O2S — CID 23023739

IUPAC5-amino-1,3-thiazole-4-carboxylic acid
SMILESNc1scnc1C(=O)O
InChIInChI=1S/C4H4N2O2S/c5-3-2(4(7)8)6-1-9-3/h1H,5H2,(H,7,8)
InChIKeyFSMITCDFXHXTIC-UHFFFAOYSA-N
MW144.16 g/mol
LogP0.42
Rot. Bonds1

About 5-amino-1,3-thiazole-4-carboxylic acid

5-amino-1,3-thiazole-4-carboxylic acid (PubChem CID 23023739) has the molecular formula C4H4N2O2S and a molecular weight of 144.16 g/mol. Its IUPAC name is 5-amino-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-amino-1,3-thiazole-4-carboxylic acid
PubChem CID23023739
Molecular FormulaC4H4N2O2S
Molecular Weight144.16 g/mol
Exact Mass144.00
IUPAC Name5-amino-1,3-thiazole-4-carboxylic acid
SMILESNc1scnc1C(=O)O
InChIInChI=1S/C4H4N2O2S/c5-3-2(4(7)8)6-1-9-3/h1H,5H2,(H,7,8)
InChIKeyFSMITCDFXHXTIC-UHFFFAOYSA-N
XLogP0.42
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.16
LogP ≤ 50.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-1,3-thiazole-4-carboxylic acid (CID 23023739) is 5-amino-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-1,3-thiazole-4-carboxylic acid is Nc1scnc1C(=O)O.
What is the InChIKey of 5-amino-1,3-thiazole-4-carboxylic acid?
The InChIKey is FSMITCDFXHXTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c5-3-2(4(7)8)6-1-9-3/h1H,5H2,(H,7,8).
What are the key properties of 5-amino-1,3-thiazole-4-carboxylic acid?
5-amino-1,3-thiazole-4-carboxylic acid has a molecular weight of 144.16 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 23023739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).