C9H13BrO — CID 130020507
5-bromo-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 130020507) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is 5-bromo-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 5-bromo-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 130020507 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 5-bromo-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CC(Br)C1CC2=O |
| InChI | InChI=1S/C9H13BrO/c1-9(2)5-4-8(11)6(9)3-7(5)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | XKZNOMNLBHGGSE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|