C10H15NO3 — CID 130023883
5-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-8-carbaldehyde (PubChem CID 130023883) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 5-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-8-carbaldehyde.
| Compound Name | 5-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-8-carbaldehyde |
|---|---|
| PubChem CID | 130023883 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 5-hydroxy-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoline-8-carbaldehyde |
| SMILES | O=CC1CCC(O)C2CCC(=O)NC12 |
| InChI | InChI=1S/C10H15NO3/c12-5-6-1-3-8(13)7-2-4-9(14)11-10(6)7/h5-8,10,13H,1-4H2,(H,11,14) |
| InChIKey | QZHXKQXLRXOYHO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|