C6H9NO4 — CID 162389558
2,5-dioxopyrrolidine-3-carbaldehyde;methanol (PubChem CID 162389558) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is 2,5-dioxopyrrolidine-3-carbaldehyde;methanol.
| Compound Name | 2,5-dioxopyrrolidine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 162389558 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 2,5-dioxopyrrolidine-3-carbaldehyde;methanol |
| SMILES | CO.O=CC1CC(=O)NC1=O |
| InChI | InChI=1S/C5H5NO3.CH4O/c7-2-3-1-4(8)6-5(3)9;1-2/h2-3H,1H2,(H,6,8,9);2H,1H3 |
| InChIKey | AUAKNEGVMKCPKM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|