C8H10O4 — CID 130031710
3-(1-hydroxyethyl)-6-methylpyran-2,4-dione (PubChem CID 130031710) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-6-methylpyran-2,4-dione.
| Compound Name | 3-(1-hydroxyethyl)-6-methylpyran-2,4-dione |
|---|---|
| PubChem CID | 130031710 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-(1-hydroxyethyl)-6-methylpyran-2,4-dione |
| SMILES | CC1=CC(=O)C(C(C)O)C(=O)O1 |
| InChI | InChI=1S/C8H10O4/c1-4-3-6(10)7(5(2)9)8(11)12-4/h3,5,7,9H,1-2H3 |
| InChIKey | NQUOVCCVPYZAHC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|