C10H9NO — CID 130031886
5-methylidene-4a,8a-dihydroquinolin-8-one (PubChem CID 130031886) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-methylidene-4a,8a-dihydroquinolin-8-one.
| Compound Name | 5-methylidene-4a,8a-dihydroquinolin-8-one |
|---|---|
| PubChem CID | 130031886 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-methylidene-4a,8a-dihydroquinolin-8-one |
| SMILES | C=C1C=CC(=O)C2N=CC=CC12 |
| InChI | InChI=1S/C10H9NO/c1-7-4-5-9(12)10-8(7)3-2-6-11-10/h2-6,8,10H,1H2 |
| InChIKey | JVQPFRSXNTWFTJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |