C9H11NO2 — CID 130036349
2,5,8,9a-tetrahydro-1H-pyrrolo[1,2-a]azepine-3,9-dione (PubChem CID 130036349) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2,5,8,9a-tetrahydro-1H-pyrrolo[1,2-a]azepine-3,9-dione.
| Compound Name | 2,5,8,9a-tetrahydro-1H-pyrrolo[1,2-a]azepine-3,9-dione |
|---|---|
| PubChem CID | 130036349 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2,5,8,9a-tetrahydro-1H-pyrrolo[1,2-a]azepine-3,9-dione |
| SMILES | O=C1CC=CCN2C(=O)CCC12 |
| InChI | InChI=1S/C9H11NO2/c11-8-3-1-2-6-10-7(8)4-5-9(10)12/h1-2,7H,3-6H2 |
| InChIKey | POTNXWGJJLKIOC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|