C9H8INO2 — CID 130040369
6-iodo-2,3-dihydro-1H-isoindole-1-carboxylic acid (PubChem CID 130040369) has the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. Its IUPAC name is 6-iodo-2,3-dihydro-1H-isoindole-1-carboxylic acid.
| Compound Name | 6-iodo-2,3-dihydro-1H-isoindole-1-carboxylic acid |
|---|---|
| PubChem CID | 130040369 |
| Molecular Formula | C9H8INO2 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 6-iodo-2,3-dihydro-1H-isoindole-1-carboxylic acid |
| SMILES | O=C(O)C1NCc2ccc(I)cc21 |
| InChI | InChI=1S/C9H8INO2/c10-6-2-1-5-4-11-8(9(12)13)7(5)3-6/h1-3,8,11H,4H2,(H,12,13) |
| InChIKey | MEGIPWZKPZBIRC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|