C18H17N3O4S — CID 1300581
N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 1300581) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 1300581 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3cc(C)on3)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-12-3-9-16(10-4-12)26(23,24)21-15-7-5-14(6-8-15)18(22)19-17-11-13(2)25-20-17/h3-11,21H,1-2H3,(H,19,20,22) |
| InChIKey | NPAUELDNSYIBKW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |