C9H8FNS — CID 130064247
4-ethyl-7-fluoro-1,2-benzothiazole (PubChem CID 130064247) has the molecular formula C9H8FNS and a molecular weight of 181.23 g/mol. Its IUPAC name is 4-ethyl-7-fluoro-1,2-benzothiazole.
| Compound Name | 4-ethyl-7-fluoro-1,2-benzothiazole |
|---|---|
| PubChem CID | 130064247 |
| Molecular Formula | C9H8FNS |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 4-ethyl-7-fluoro-1,2-benzothiazole |
| SMILES | CCc1ccc(F)c2sncc12 |
| InChI | InChI=1S/C9H8FNS/c1-2-6-3-4-8(10)9-7(6)5-11-12-9/h3-5H,2H2,1H3 |
| InChIKey | FKOMIADDQHZINS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |