C9H7ClN2O2 — CID 130064894
5-chloro-7-methylimidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 130064894) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-chloro-7-methylimidazo[1,2-a]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-7-methylimidazo[1,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130064894 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-chloro-7-methylimidazo[1,2-a]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)n2c(C(=O)O)cnc2c1 |
| InChI | InChI=1S/C9H7ClN2O2/c1-5-2-7(10)12-6(9(13)14)4-11-8(12)3-5/h2-4H,1H3,(H,13,14) |
| InChIKey | FKTWNEOKLBFISG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|