C10H10N4 — CID 130065485
3-amino-5-ethylimidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 130065485) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 3-amino-5-ethylimidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 3-amino-5-ethylimidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 130065485 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3-amino-5-ethylimidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | CCc1c(C#N)ccc2ncc(N)n12 |
| InChI | InChI=1S/C10H10N4/c1-2-8-7(5-11)3-4-10-13-6-9(12)14(8)10/h3-4,6H,2,12H2,1H3 |
| InChIKey | HMESSOMWOZDRSJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |