C9H5N5 — CID 130065666
3-aminoimidazo[1,2-a]pyridine-7,8-dicarbonitrile (PubChem CID 130065666) has the molecular formula C9H5N5 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3-aminoimidazo[1,2-a]pyridine-7,8-dicarbonitrile.
| Compound Name | 3-aminoimidazo[1,2-a]pyridine-7,8-dicarbonitrile |
|---|---|
| PubChem CID | 130065666 |
| Molecular Formula | C9H5N5 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-aminoimidazo[1,2-a]pyridine-7,8-dicarbonitrile |
| SMILES | N#Cc1ccn2c(N)cnc2c1C#N |
| InChI | InChI=1S/C9H5N5/c10-3-6-1-2-14-8(12)5-13-9(14)7(6)4-11/h1-2,5H,12H2 |
| InChIKey | RQEKACOMOAKGER-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |