About 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile
5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile (PubChem CID 177024639) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile.
Analyze 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile?
The IUPAC name of 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile (CID 177024639) is 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile.
What is the SMILES notation for 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile?
The canonical SMILES for 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile is Cc1nc(C)n2ccnc2c1C#N.
What is the InChIKey of 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile?
The InChIKey is MRCJMRBJPCYYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-6-8(5-10)9-11-3-4-13(9)7(2)12-6/h3-4H,1-2H3.
What are the key properties of 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile?
5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile has a molecular weight of 172.19 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylimidazo[1,2-c]pyrimidine-8-carbonitrile is sourced from PubChem (CID 177024639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).