C7H5F2N3O3S — CID 130077095
5-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide (PubChem CID 130077095) has the molecular formula C7H5F2N3O3S and a molecular weight of 249.20 g/mol. Its IUPAC name is 5-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide.
| Compound Name | 5-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide |
|---|---|
| PubChem CID | 130077095 |
| Molecular Formula | C7H5F2N3O3S |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 5-cyano-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide |
| SMILES | N#Cc1cnc(C(F)F)c(O)c1S(N)(=O)=O |
| InChI | InChI=1S/C7H5F2N3O3S/c8-7(9)4-5(13)6(16(11,14)15)3(1-10)2-12-4/h2,7,13H,(H2,11,14,15) |
| InChIKey | HSPHOIFRWVJSRY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |