C8H8F3NO — CID 130081112
[3-(difluoromethyl)-4-fluoro-5-methyl-2-pyridinyl]methanol (PubChem CID 130081112) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-fluoro-5-methyl-2-pyridinyl]methanol.
| Compound Name | [3-(difluoromethyl)-4-fluoro-5-methyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 130081112 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | [3-(difluoromethyl)-4-fluoro-5-methyl-2-pyridinyl]methanol |
| SMILES | Cc1cnc(CO)c(C(F)F)c1F |
| InChI | InChI=1S/C8H8F3NO/c1-4-2-12-5(3-13)6(7(4)9)8(10)11/h2,8,13H,3H2,1H3 |
| InChIKey | IGCVHWGMUITTIP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |