C8H9F2NO — CID 130101153
4-(difluoromethyl)-3,5-dimethyl-1H-pyridin-2-one (PubChem CID 130101153) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is 4-(difluoromethyl)-3,5-dimethyl-1H-pyridin-2-one.
| Compound Name | 4-(difluoromethyl)-3,5-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130101153 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 4-(difluoromethyl)-3,5-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1c[nH]c(=O)c(C)c1C(F)F |
| InChI | InChI=1S/C8H9F2NO/c1-4-3-11-8(12)5(2)6(4)7(9)10/h3,7H,1-2H3,(H,11,12) |
| InChIKey | ZPXWXGGQIOETBL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |