C7H9ClN2O2 — CID 130116377
5-(chloromethyl)-2,3-dimethoxypyrazine (PubChem CID 130116377) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-dimethoxypyrazine.
| Compound Name | 5-(chloromethyl)-2,3-dimethoxypyrazine |
|---|---|
| PubChem CID | 130116377 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 5-(chloromethyl)-2,3-dimethoxypyrazine |
| SMILES | COc1ncc(CCl)nc1OC |
| InChI | InChI=1S/C7H9ClN2O2/c1-11-6-7(12-2)10-5(3-8)4-9-6/h4H,3H2,1-2H3 |
| InChIKey | FHECZJRHGYAOSI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|