C8H10N2O2 — CID 163871924
5-ethenyl-2,3-dimethoxypyrazine (PubChem CID 163871924) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-ethenyl-2,3-dimethoxypyrazine.
| Compound Name | 5-ethenyl-2,3-dimethoxypyrazine |
|---|---|
| PubChem CID | 163871924 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-ethenyl-2,3-dimethoxypyrazine |
| SMILES | C=Cc1cnc(OC)c(OC)n1 |
| InChI | InChI=1S/C8H10N2O2/c1-4-6-5-9-7(11-2)8(10-6)12-3/h4-5H,1H2,2-3H3 |
| InChIKey | PLNZWPIKGNJRCU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |