C6H9N3O2 — CID 45122049
3,6-dimethoxypyrazin-2-amine (PubChem CID 45122049) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 3,6-dimethoxypyrazin-2-amine.
| Compound Name | 3,6-dimethoxypyrazin-2-amine |
|---|---|
| PubChem CID | 45122049 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3,6-dimethoxypyrazin-2-amine |
| SMILES | COc1cnc(OC)c(N)n1 |
| InChI | InChI=1S/C6H9N3O2/c1-10-4-3-8-6(11-2)5(7)9-4/h3H,1-2H3,(H2,7,9) |
| InChIKey | UXMDNQYOWYWTPP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |