C16H18N6O — CID 13011931
1-(4-phenylbutyl)-3-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea (PubChem CID 13011931) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(4-phenylbutyl)-3-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea.
| Compound Name | 1-(4-phenylbutyl)-3-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 13011931 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(4-phenylbutyl)-3-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)urea |
| SMILES | O=C(NCCCCc1ccccc1)Nc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C16H18N6O/c23-16(17-9-5-4-8-12-6-2-1-3-7-12)21-14-13-10-20-22-15(13)19-11-18-14/h1-3,6-7,10-11H,4-5,8-9H2,(H3,17,18,19,20,21,22,23) |
| InChIKey | CSQDKTPZBGCMRH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|