C11H18O — CID 130125116
4-cyclopentylhexa-4,5-dien-3-ol (PubChem CID 130125116) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-cyclopentylhexa-4,5-dien-3-ol.
| Compound Name | 4-cyclopentylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 130125116 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-cyclopentylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(C(O)CC)C1CCCC1 |
| InChI | InChI=1S/C11H18O/c1-3-10(11(12)4-2)9-7-5-6-8-9/h9,11-12H,1,4-8H2,2H3 |
| InChIKey | NFWAQHMYPQDRMI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |