C11H21NO2 — CID 13012624
5-[(dimethylamino)methyl]-2,2,5-trimethyloxan-4-one (PubChem CID 13012624) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-2,2,5-trimethyloxan-4-one.
| Compound Name | 5-[(dimethylamino)methyl]-2,2,5-trimethyloxan-4-one |
|---|---|
| PubChem CID | 13012624 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 5-[(dimethylamino)methyl]-2,2,5-trimethyloxan-4-one |
| SMILES | CN(C)CC1(C)COC(C)(C)CC1=O |
| InChI | InChI=1S/C11H21NO2/c1-10(2)6-9(13)11(3,8-14-10)7-12(4)5/h6-8H2,1-5H3 |
| InChIKey | VDSUUDXRCCYGCK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |