C21H28BrNO2 — CID 23622651
bromomethane;N,N-dimethyl-1-(5-methyl-2,2-diphenyl-1,3-dioxan-5-yl)methanamine (PubChem CID 23622651) has the molecular formula C21H28BrNO2 and a molecular weight of 406.36 g/mol. Its IUPAC name is bromomethane;N,N-dimethyl-1-(5-methyl-2,2-diphenyl-1,3-dioxan-5-yl)methanamine.
| Compound Name | bromomethane;N,N-dimethyl-1-(5-methyl-2,2-diphenyl-1,3-dioxan-5-yl)methanamine |
|---|---|
| PubChem CID | 23622651 |
| Molecular Formula | C21H28BrNO2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | bromomethane;N,N-dimethyl-1-(5-methyl-2,2-diphenyl-1,3-dioxan-5-yl)methanamine |
| SMILES | CBr.CN(C)CC1(C)COC(c2ccccc2)(c2ccccc2)OC1 |
| InChI | InChI=1S/C20H25NO2.CH3Br/c1-19(14-21(2)3)15-22-20(23-16-19,17-10-6-4-7-11-17)18-12-8-5-9-13-18;1-2/h4-13H,14-16H2,1-3H3;1H3 |
| InChIKey | GGMJORKIWLIKNR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|