C8H14O — CID 130126331
3,4-dimethylidenehexan-2-ol (PubChem CID 130126331) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is 3,4-dimethylidenehexan-2-ol.
| Compound Name | 3,4-dimethylidenehexan-2-ol |
|---|---|
| PubChem CID | 130126331 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 3,4-dimethylidenehexan-2-ol |
| SMILES | C=C(CC)C(=C)C(C)O |
| InChI | InChI=1S/C8H14O/c1-5-6(2)7(3)8(4)9/h8-9H,2-3,5H2,1,4H3 |
| InChIKey | OQKOTJHSMUNCGZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|